HematoxLong2023 / Preprocessing Script.py
haneulpark's picture
Update Preprocessing Script.py
7605b4f verified
## Script to sanitize and split HematoxLong2023 dataset
# 1. Load modules
pip install rdkit
pip install molvs
import pandas as pd
import numpy as np
import urllib.request
import tqdm
import rdkit
from rdkit import Chem
import molvs
standardizer = molvs.Standardizer()
fragment_remover = molvs.fragment.FragmentRemover()
#2. Download the original dataset
# Download SI Table 2 from
#. Structural Analysis and Prediction of Hematotoxicity Using Deep Learning Approaches
#. Teng-Zhi Long, Shao-Hua Shi, Shao Liu, Ai-Ping Lu, Zhao-Qian Liu, Min Li, Ting-Jun Hou*, and Dong-Sheng Cao*
#. J. Chem. Inf. Model. 2023, 63, 1, 111–125
#. https://doi.org/10.1021/acs.jcim.2c01088
urllib.request.urlretrieve(
url = "https://ndownloader.figstatic.com/files/38442996",
filename = "Long2023_SI2.xls")
Long2023 = pd.read_excel(
io = "Long2023_SI2.xls",
sheet_name = "all_data",
engine = "xlrd",
names = ['SMILES', 'Y'])
Long2023['ID'] = [f"Long2023_{i}" for i in range(len(Long2023.index))]
#3. Resolve SMILES parse error
# failed to parse smiles, looked it up in ChemSpider and found Octahydro-1H-purine-6-thiol
# (Found by conversion of search term to chemical structure (connectivity match))
# https://www.chemspider.com/Chemical-Structure.114454999.html?rid=8f8bdf21-6482-44e5-adc9-71c5aef41627
Long2023.loc[Long2023['SMILES'] == 'Sc1[nH]cnc-2[n+H]cnc1-2', 'SMILES'] = "SC1NCNC2NCNC21"
# failed to parse smiles, looked it up in Pubchem and found 2-Amino-3,7-dihydropurin-1-ium-6-thione
# https://pubchem.ncbi.nlm.nih.gov/compound/117071895
Long2023.loc[Long2023['SMILES'] == 'Sc1nc(N)nc2[n+H]c[nH]c12', 'SMILES'] = "C1=NC2=C(N1)C(=S)[NH+]=C(N2)N"
# failed to parse smiles, looked it up in ChemSpider and found gentamicin
# (Found by conversion of search term to chemical structure (connectivity match))
# The approved drug gentamicin is a complex of three closely-related aminoglycoside sulfates: C1, C1a and C2
# It's unclear from the smiles, if they used just one of the forms or the mixture of all three
# Clinically, there appears to be a wide range of compositions of C1, C1a, C2 forms (!)
# Here, we'll just use the C1 form (https://www.ebi.ac.uk/chebi/searchId.do;D579C431E9548A30AFBD88A2D05CA777?chebiId=CHEBI:27412)
Long2023.loc[Long2023['SMILES'] == 'O(C1C(O)C(OC2C(O)C([N+H2]C)[C@](O)(C)CO2)C(N)CC1N)C1C([N+H3])CCC(C([N+H2]C)C)O1', 'SMILES'] = \
"CNC(C)[C@@H]1CC[C@@H](N)[C@H](O1)O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2OC[C@](C)(O)[C@H](NC)[C@H]2O)[C@H]1O"
# failed to parse smiles, looked it up in ChemSpider and found (2S)-2-Hydroxy-N-isopropyl-3-(1-naphthyloxy)-1-propanaminium
# (Found by conversion of search term to chemical structure (connectivity match))
# https://www.chemspider.com/Chemical-Structure.5296478.html?rid=129380a1-888e-48d0-b240-43646b288842
Long2023.loc[Long2023['SMILES'] == 'O(C[C@@H](O)C[N+H2]C(C)C)c1c2c(ccc1)cccc2', 'SMILES'] = \
"O[C@@H](C[NH2+]C(C)C)COc2cccc1ccccc12"
# failed to parse smiles, looked it up in ChemSpider, removing charge and H from nitrogens
# matches Periciazine, which I think is what this compound is
# https://www.chemspider.com/Chemical-Structure.4585.html?rid=0694332f-3886-4df1-85d4-8cdb11554c3d
Long2023.loc[Long2023['SMILES'] == 'OC1CC[N+H](CCC[N+@H]2c3c(Sc4c2cccc4)ccc(C#N)c3)CC1', 'SMILES'] = \
"c1ccc2c(c1)N(c3cc(ccc3S2)C#N)CCCN4CCC(CC4)O"
# failed to parse smiles, looked it up in ChemSpider and found idarubicin
# (Found by conversion of search term to chemical structure (connectivity match))
# Idarubicin, or 4-demethoxydaunorubicin is an anthracycline antileukemic drug.
# https://www.chemspider.com/Chemical-Structure.39117.html?rid=a418032b-d8ab-4200-9226-bcb194221cf0&page_num=0
Long2023.loc[Long2023['SMILES'] == 'O=C(C)[C@@]1(O)CC(OC2OC(C)C(O)C([N+H3])C2)c2c(O)c3C(=O)c4c(C(=O)c3c(O)c2C1)cccc4', 'SMILES'] = \
"C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](Cc3c2c(c4c(c3O)C(=O)c5ccccc5C4=O)O)(C(=O)C)O)N)O"
# failed to parse smiles, looked it up in ChemSpider and found (2S)-5-[(6-Methoxy-8-quinolinyl)amino]-2-pentanaminium
# (Found by conversion of search term to chemical structure (full match))
# https://www.chemspider.com/Chemical-Structure.1291555.html?rid=b22e2c45-078e-48d9-8907-22deb37bed0c
Long2023.loc[Long2023['SMILES'] == 'O(C)c1cc(NCCC[C@@H]([N+H3])C)c2ncccc2c1', 'SMILES'] = "C[C@@H](CCCNc1cc(cc2c1nccc2)OC)[NH3+]"
# failed to parse smiles, looked it up in PUbchem
# found diethyl-[2-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carbonyl]amino]ethyl]azanium
# https://pubchem.ncbi.nlm.nih.gov/compound/40469377
Long2023.loc[Long2023['SMILES'] == 'Fc1cc2/C(=C/c3c(C)c(C(=O)NCC[N+H](CC)CC)c(C)[nH]3)/C(=O)Nc2cc1', 'SMILES'] = \
"CC[NH+](CC)CCNC(=O)C1=C(NC(=C1C)C=C2C3=C(C=CC(=C3)F)NC2=O)C"
# failed to parse smiles, looked it up in ChemSpider
# found 1-Methyl-4-{4-[(4-methyl-3-{[4-(3-pyridinyl)-2-pyrimidinyl]amino}phenyl)carbamoyl]benzyl}piperazin-1-ium
# (Found by conversion of search term to chemical structure (full match))
# https://www.chemspider.com/Chemical-Structure.13082883.html?rid=8baa4568-3947-473e-9fdc-8872f411694c#synonymsTab
Long2023.loc[Long2023['SMILES'] == 'O=C([N+H2]c1cc(Nc2nc(-c3cnccc3)ccn2)c(C)cc1)c1ccc(CN2CCN(C)CC2)cc1', 'SMILES'] = \
"Cc1ccc(cc1Nc2nccc(n2)c3cccnc3)NC(=O)c4ccc(cc4)CN5CC[NH+](CC5)C"
# failed to parse smiles, looked it up in ChemSpider and found 6-Chloro-9-{[(2S)-5-(diethylammonio)-2-pentanyl]amino}-2-methoxyacridinium
# (Found by conversion of search term to chemical structure (full match))
# https://www.chemspider.com/Chemical-Structure.5408834.html?rid=c1cdd9c2-d48b-4cd4-945d-606bf2bff1ee
Long2023.loc[Long2023['SMILES'] == 'Clc1cc2[n+H]c3c(c(N[C@H](CCC[N+H](CC)CC)C)c2cc1)cc(OC)cc3', 'SMILES'] = \
"Clc3ccc2c(c1cc(OC)ccc1[nH+]c2c3)N[C@@H](C)CCC[NH+](CC)CC"
# failed to parse smiles, looked it up in ChemSpider, removing charge
# found Carvedilol
# (Found by conversion of search term to chemical structure (connectivity match))
# Carvedilol is a beta-blocker medication, that may be prescribed for treating high blood pressure and chronic heart failure with reduced ejection fraction.
# https://www.chemspider.com/Chemical-Structure.2487.html?rid=f8358443-8c32-4e5f-b1d8-47ad13ea8a16&page_num=0
Long2023.loc[Long2023['SMILES'] == 'O(CC[N+H2]C[C@H](O)COc1c-2c([N+H2]c3c-2cccc3)ccc1)c1c(OC)cccc1', 'SMILES'] = \
"COc1ccccc1OCCNCC(COc2cccc3c2c4ccccc4[nH]3)O"
# failed to parse smiles, looked it up in ChemSpider, found (2S)-1-(2,6-Dimethylphenoxy)-2-propanaminium
# (Found by conversion of search term to chemical structure (full match))
# https://www.chemspider.com/Chemical-Structure.5296573.html?rid=c8c0121e-fad3-4458-8c64-a0baa3e18358
Long2023.loc[Long2023['SMILES'] == 'O(C[C@@H]([N+H3])C)c1c(C)cccc1C', 'SMILES'] = \
"O(c1c(cccc1C)C)C[C@@H]([NH3+])C"
# failed to parse smiles, looked it up in ChemSpider and found 4-{2-[(5-Cyano-5,5-diphenylpentyl)(methyl)amino]ethyl}-4-methylmorpholin-4-ium
# (Found by conversion of search term to chemical structure (connectivity match))
# https://www.chemspider.com/Chemical-Structure.2310136.html?rid=ce2b48f6-04d6-4df3-ad71-b6507906c7cb
Long2023.loc[Long2023['SMILES'] == '[N+@H](CCCCC(C#N)(c1ccccc1)c1ccccc1)(CC[N+]1(C)CCOCC1)C', 'SMILES'] = \
"CN(CCCCC(C#N)(c1ccccc1)c2ccccc2)CC[N+]3(CCOCC3)C"
# failed to parse smiles, looked it up in ChemSpider
# found (5E)-3-[(2R,6S)-2,6-Dimethyl-1-piperidinyl]-5-[(4-methoxybenzoyl)imino]-4,5-dihydro-1,2,3-oxadiazol-3-ium-4-ide
# (Found by conversion of search term to chemical structure (full match))
# https://www.chemspider.com/Chemical-Structure.28530638.html?rid=b44dbe3c-24f1-4303-8deb-82b879b7f0e0
Long2023.loc[Long2023['SMILES'] == 'O=C(/N=C1/ON=[N+](N2[C@@H](C)CCC[C@H]2C)[C-H]/1)c1ccc(OC)cc1', 'SMILES'] = \
"C[C@@H]1CCC[C@@H](N1[n+]2[cH-]/c(=N\C(=O)c3ccc(cc3)OC)/on2)C"
# failed to parse smiles, looked it up in Pubchem
# found ((R)-[(2S)-7-ethenyl-1-azabicyclo[2.2.1]heptan-2-yl]-(6-methoxyquinolin-4-yl)methanol
# https://pubchem.ncbi.nlm.nih.gov/compound/139247817
Long2023.loc[Long2023['SMILES'] == 'O(C)c1cc2c([C@@H](O)[C@@H]3[N+@H]4[C@@H](C=C)[C@H](C3)CC4)ccnc2cc1', 'SMILES'] = \
"COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3C4C=C)O"
#4. Sanitize with MolVS and print problems
Long2023['X'] = [ \
rdkit.Chem.MolToSmiles(
fragment_remover.remove(
standardizer.standardize(
rdkit.Chem.MolFromSmiles(
smiles))))
for smiles in Long2023['SMILES']]
problems = []
for index, row in tqdm.tqdm(Long2023.iterrows()):
result = molvs.validate_smiles(row['X'])
if len(result) == 0:
continue
problems.append( (row['ID'], result) )
# Most are because it includes the salt form and/or it is not neutralized
for id, alert in problems:
print(f"ID: {id}, problem: {alert[0]}")
# Result interpretation
# - Can't kekulize mol: The error message means that kekulization would break the molecules down, so it couldn't proceed
# It doesn't mean that the molecules are bad, it just means that normalization failed
# - () is present: The error message is not about a salt, not about a fragment,
# It is showing there is a molecule () (ex) Benzene is present
#5. Select columns and rename the dataset
Long2023.rename(columns={'X': 'new SMILES', 'Y': 'Label'}, inplace=True)
HematoxLong2023 = Long2023[['new SMILES', 'Label']]
#6. Import modules to split the dataset
import sys
from rdkit import DataStructs
from rdkit.Chem import AllChem as Chem
from rdkit.Chem import PandasTools
#7. Split the dataset into test and train
class MolecularFingerprint:
def __init__(self, fingerprint):
self.fingerprint = fingerprint
def __str__(self):
return self.fingerprint.__str__()
def compute_fingerprint(molecule):
try:
fingerprint = Chem.GetMorganFingerprintAsBitVect(molecule, 2, nBits=1024)
result = np.zeros(len(fingerprint), np.int32)
DataStructs.ConvertToNumpyArray(fingerprint, result)
return MolecularFingerprint(result)
except:
print("Fingerprints for a structure cannot be calculated")
return None
def tanimoto_distances_yield(fingerprints, num_fingerprints):
for i in range(1, num_fingerprints):
yield [1 - x for x in DataStructs.BulkTanimotoSimilarity(fingerprints[i], fingerprints[:i])]
def cluster_data(fingerprints, num_points, distance_threshold, reordering=False):
nbr_lists = [None] * num_points
for i in range(num_points):
nbr_lists[i] = []
dist_fun = tanimoto_distances_yield(fingerprints, num_points)
for i in range(1, num_points):
dists = next(dist_fun)
for j in range(i):
dij = dists[j]
if dij <= distance_threshold:
nbr_lists[i].append(j)
nbr_lists[j].append(i)
t_lists = [(len(y), x) for x, y in enumerate(nbr_lists)]
t_lists.sort(reverse=True)
res = []
seen = [0] * num_points
while t_lists:
_, idx = t_lists.pop(0)
if seen[idx]:
continue
t_res = [idx]
for nbr in nbr_lists[idx]:
if not seen[nbr]:
t_res.append(nbr)
seen[nbr] = 1
if reordering:
nbr_nbr = [nbr_lists[t] for t in t_res]
nbr_nbr = frozenset().union(*nbr_nbr)
for x, y in enumerate(t_lists):
y1 = y[1]
if seen[y1] or (y1 not in nbr_nbr):
continue
nbr_lists[y1] = set(nbr_lists[y1]).difference(t_res)
t_lists[x] = (len(nbr_lists[y1]), y1)
t_lists.sort(reverse=True)
res.append(tuple(t_res))
return tuple(res)
def cluster_fingerprints(fingerprints, method="Auto"):
num_fingerprints = len(fingerprints)
if method == "Auto":
method = "TB" if num_fingerprints >= 10000 else "Hierarchy"
if method == "TB":
cutoff = 0.56
print("Butina clustering is selected. Dataset size is:", num_fingerprints)
clusters = cluster_data(fingerprints, num_fingerprints, cutoff)
elif method == "Hierarchy":
import scipy.spatial.distance as ssd
from scipy.cluster import hierarchy
print("Hierarchical clustering is selected. Dataset size is:", num_fingerprints)
av_cluster_size = 8
dists = []
for i in range(0, num_fingerprints):
sims = DataStructs.BulkTanimotoSimilarity(fingerprints[i], fingerprints)
dists.append([1 - x for x in sims])
dis_array = ssd.squareform(dists)
Z = hierarchy.linkage(dis_array)
average_cluster_size = av_cluster_size
cluster_amount = int(num_fingerprints / average_cluster_size)
clusters = hierarchy.cut_tree(Z, n_clusters=cluster_amount)
clusters = list(clusters.transpose()[0])
cs = []
for i in range(max(clusters) + 1):
cs.append([])
for i in range(len(clusters)):
cs[clusters[i]].append(i)
return cs
def split_dataframe(dataframe, smiles_col_index, fraction_to_train, split_for_exact_fraction=True, cluster_method="Auto"):
try:
import math
smiles_column_name = dataframe.columns[smiles_col_index]
molecule = 'molecule'
fingerprint = 'fingerprint'
group = 'group'
testing = 'testing'
try:
PandasTools.AddMoleculeColumnToFrame(dataframe, smiles_column_name, molecule)
except:
print("Exception occurred during molecule generation...")
dataframe = dataframe.loc[dataframe[molecule].notnull()]
dataframe[fingerprint] = [compute_fingerprint(m) for m in dataframe[molecule]]
dataframe = dataframe.loc[dataframe[fingerprint].notnull()]
fingerprints = [Chem.GetMorganFingerprintAsBitVect(m, 2, nBits=2048) for m in dataframe[molecule]]
clusters = cluster_fingerprints(fingerprints, method=cluster_method)
dataframe.drop([molecule, fingerprint], axis=1, inplace=True)
last_training_index = int(math.ceil(len(dataframe) * fraction_to_train))
clustered = None
cluster_no = 0
mol_count = 0
for cluster in clusters:
cluster_no = cluster_no + 1
try:
one_cluster = dataframe.iloc[list(cluster)].copy()
except:
print("Wrong indexes in Cluster: %i, Molecules: %i" % (cluster_no, len(cluster)))
continue
one_cluster.loc[:, 'ClusterNo'] = cluster_no
one_cluster.loc[:, 'MolCount'] = len(cluster)
if (mol_count < last_training_index) or (cluster_no < 2):
one_cluster.loc[:, group] = 'training'
else:
one_cluster.loc[:, group] = testing
mol_count += len(cluster)
clustered = pd.concat([clustered, one_cluster], ignore_index=True)
if split_for_exact_fraction:
print("Adjusting test to train ratio. It may split one cluster")
clustered.loc[last_training_index + 1:, group] = testing
print("Clustering finished. Training set size is %i, Test set size is %i, Fraction %.2f" %
(len(clustered.loc[clustered[group] != testing]),
len(clustered.loc[clustered[group] == testing]),
len(clustered.loc[clustered[group] == testing]) / len(clustered)))
except KeyboardInterrupt:
print("Clustering interrupted.")
return clustered
def realistic_split(df, smile_col_index, frac_train, split_for_exact_frac=True, cluster_method = "Auto"):
return split_dataframe(df.copy(), smile_col_index, frac_train, split_for_exact_frac, cluster_method=cluster_method)
def split_df_into_train_and_test_sets(df):
df['group'] = df['group'].str.replace(' ', '_')
df['group'] = df['group'].str.lower()
train = df[df['group'] == 'training']
test = df[df['group'] == 'testing']
return train, test
# 8. Test and train datasets have been made
smiles_index = 0 # Because smiles is in the first column
realistic = realistic_split(HematoxLong2023.copy(), smiles_index, 0.75, split_for_exact_frac=True, cluster_method="Auto")
realistic_train, realistic_test = split_df_into_train_and_test_sets(realistic)
#9. Select columns and name the datasets
selected_columns = realistic_train[['new SMILES', 'Label']]
selected_columns.to_csv("HematoxLong2023_train.csv", index=False)
selected_columns = realistic_test[['new SMILES', 'Label']]
selected_columns.to_csv("HematoxLong2023_test.csv", index=False)